C18H28N6O5 — CID 3717283
ethyl 4-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 3717283) has the molecular formula C18H28N6O5 and a molecular weight of 408.46 g/mol. Its IUPAC name is ethyl 4-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3717283 |
| Molecular Formula | C18H28N6O5 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | ethyl 4-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ncnc(N3CC(C)OC(C)C3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H28N6O5/c1-4-28-18(25)22-7-5-14(6-8-22)21-16-15(24(26)27)17(20-11-19-16)23-9-12(2)29-13(3)10-23/h11-14H,4-10H2,1-3H3,(H,19,20,21) |
| InChIKey | ZOSFFXPZNDUBEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|