C17H29N7O4 — CID 3666516
ethyl 4-[[6-[2-(dimethylamino)ethyl-methylamino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 3666516) has the molecular formula C17H29N7O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-[[6-[2-(dimethylamino)ethyl-methylamino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-[2-(dimethylamino)ethyl-methylamino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3666516 |
| Molecular Formula | C17H29N7O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | ethyl 4-[[6-[2-(dimethylamino)ethyl-methylamino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ncnc(N(C)CCN(C)C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H29N7O4/c1-5-28-17(25)23-8-6-13(7-9-23)20-15-14(24(26)27)16(19-12-18-15)22(4)11-10-21(2)3/h12-13H,5-11H2,1-4H3,(H,18,19,20) |
| InChIKey | ABGGTOXCQRZUKC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|