C18H31N5O2 — CID 112862856
ethyl 4-[[6-(dipropylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 112862856) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is ethyl 4-[[6-(dipropylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(dipropylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112862856 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | ethyl 4-[[6-(dipropylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCCN(CCC)c1cc(NC2CCN(C(=O)OCC)CC2)ncn1 |
| InChI | InChI=1S/C18H31N5O2/c1-4-9-22(10-5-2)17-13-16(19-14-20-17)21-15-7-11-23(12-8-15)18(24)25-6-3/h13-15H,4-12H2,1-3H3,(H,19,20,21) |
| InChIKey | KQGORCZMAVYHNZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |