C20H32N4O3 — CID 109160189
ethyl 4-[[5-(dipropylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 109160189) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is ethyl 4-[[5-(dipropylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(dipropylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109160189 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | ethyl 4-[[5-(dipropylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC2CCN(C(=O)OCC)CC2)nc1 |
| InChI | InChI=1S/C20H32N4O3/c1-4-11-23(12-5-2)19(25)16-7-8-18(21-15-16)22-17-9-13-24(14-10-17)20(26)27-6-3/h7-8,15,17H,4-6,9-14H2,1-3H3,(H,21,22) |
| InChIKey | GCAXIFKJTUBCLX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |