C19H24N4O4 — CID 109155401
ethyl 4-[[5-(furan-2-ylmethylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 109155401) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is ethyl 4-[[5-(furan-2-ylmethylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(furan-2-ylmethylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109155401 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | ethyl 4-[[5-(furan-2-ylmethylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(C(=O)NCc3ccco3)cn2)CC1 |
| InChI | InChI=1S/C19H24N4O4/c1-2-26-19(25)23-9-7-15(8-10-23)22-17-6-5-14(12-20-17)18(24)21-13-16-4-3-11-27-16/h3-6,11-12,15H,2,7-10,13H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | BRKOVVGXVUJINY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |