C18H29N5O2 — CID 112856231
ethyl 4-[[6-(cyclohexylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 112856231) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is ethyl 4-[[6-(cyclohexylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(cyclohexylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112856231 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | ethyl 4-[[6-(cyclohexylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cc(NC3CCCCC3)ncn2)CC1 |
| InChI | InChI=1S/C18H29N5O2/c1-2-25-18(24)23-10-8-15(9-11-23)22-17-12-16(19-13-20-17)21-14-6-4-3-5-7-14/h12-15H,2-11H2,1H3,(H2,19,20,21,22) |
| InChIKey | PLMNQOKWWDVYHI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |