C20H23F3N6O4S — CID 3870364
ethyl 4-[[5-nitro-6-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 3870364) has the molecular formula C20H23F3N6O4S and a molecular weight of 500.50 g/mol. Its IUPAC name is ethyl 4-[[5-nitro-6-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-nitro-6-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3870364 |
| Molecular Formula | C20H23F3N6O4S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | ethyl 4-[[5-nitro-6-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ncnc(NCc3ccc(SC(F)(F)F)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H23F3N6O4S/c1-2-33-19(30)28-9-7-14(8-10-28)27-18-16(29(31)32)17(25-12-26-18)24-11-13-3-5-15(6-4-13)34-20(21,22)23/h3-6,12,14H,2,7-11H2,1H3,(H2,24,25,26,27) |
| InChIKey | VZKQUPBZNWVRMJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|