C12H19N5O4 — CID 102939074
[4-[6-(ethylamino)-5-nitropyrimidin-4-yl]-6-methylmorpholin-2-yl]methanol (PubChem CID 102939074) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is [4-[6-(ethylamino)-5-nitropyrimidin-4-yl]-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[6-(ethylamino)-5-nitropyrimidin-4-yl]-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102939074 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [4-[6-(ethylamino)-5-nitropyrimidin-4-yl]-6-methylmorpholin-2-yl]methanol |
| SMILES | CCNc1ncnc(N2CC(C)OC(CO)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N5O4/c1-3-13-11-10(17(19)20)12(15-7-14-11)16-4-8(2)21-9(5-16)6-18/h7-9,18H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | GAGFKPBPVRZUPK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|