C11H17N5O3 — CID 38739450
6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 38739450) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 38739450 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(N2C[C@@H](C)O[C@@H](C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N5O3/c1-7-4-15(5-8(2)19-7)11-9(16(17)18)10(12-3)13-6-14-11/h6-8H,4-5H2,1-3H3,(H,12,13,14)/t7-,8+ |
| InChIKey | CZNMQGLGGIHRNB-OCAPTIKFSA-N |
| XLogP | 1.04 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|