C9H13N5O2S — CID 112730962
N-methyl-5-nitro-6-thiomorpholin-4-ylpyrimidin-4-amine (PubChem CID 112730962) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-methyl-5-nitro-6-thiomorpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-methyl-5-nitro-6-thiomorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112730962 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-methyl-5-nitro-6-thiomorpholin-4-ylpyrimidin-4-amine |
| SMILES | CNc1ncnc(N2CCSCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O2S/c1-10-8-7(14(15)16)9(12-6-11-8)13-2-4-17-5-3-13/h6H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | HWMBOPLMLCGLFK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|