C11H18N4S — CID 80795778
N,5-dimethyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine (PubChem CID 80795778) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is N,5-dimethyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine.
| Compound Name | N,5-dimethyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80795778 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N,5-dimethyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
| SMILES | CNc1ncnc(N2CCCSCC2)c1C |
| InChI | InChI=1S/C11H18N4S/c1-9-10(12-2)13-8-14-11(9)15-4-3-6-16-7-5-15/h8H,3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | SDHNCHWXWVSMSK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |