C14H24N4S — CID 80796184
5-ethyl-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine (PubChem CID 80796184) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 5-ethyl-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine.
| Compound Name | 5-ethyl-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80796184 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-ethyl-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
| SMILES | CCCNc1ncnc(N2CCCSCC2)c1CC |
| InChI | InChI=1S/C14H24N4S/c1-3-6-15-13-12(4-2)14(17-11-16-13)18-7-5-9-19-10-8-18/h11H,3-10H2,1-2H3,(H,15,16,17) |
| InChIKey | FWCYOFKBKKFRES-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |