C11H17N5O2 — CID 23486885
N-methyl-6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23486885) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-methyl-6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-methyl-6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23486885 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-methyl-6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(N2CCCCC2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N5O2/c1-8-5-3-4-6-15(8)11-9(16(17)18)10(12-2)13-7-14-11/h7-8H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | LTNPPYWFZMLUIV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|