C20H22N6O2 — CID 23492081
2-methyl-N-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine (PubChem CID 23492081) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-methyl-N-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine.
| Compound Name | 2-methyl-N-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine |
|---|---|
| PubChem CID | 23492081 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-methyl-N-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine |
| SMILES | Cc1ccc2cccc(Nc3ncnc(N4CCCCC4C)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C20H22N6O2/c1-13-9-10-15-7-5-8-16(17(15)23-13)24-19-18(26(27)28)20(22-12-21-19)25-11-4-3-6-14(25)2/h5,7-10,12,14H,3-4,6,11H2,1-2H3,(H,21,22,24) |
| InChIKey | OOWZXIZUQOHNKW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|