C14H13N7O2 — CID 22527405
N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methylquinolin-8-amine (PubChem CID 22527405) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methylquinolin-8-amine.
| Compound Name | N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methylquinolin-8-amine |
|---|---|
| PubChem CID | 22527405 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methylquinolin-8-amine |
| SMILES | Cc1ccc2cccc(Nc3ncnc(NN)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C14H13N7O2/c1-8-5-6-9-3-2-4-10(11(9)18-8)19-13-12(21(22)23)14(20-15)17-7-16-13/h2-7H,15H2,1H3,(H2,16,17,19,20) |
| InChIKey | TVSIQDCMFFCCIV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|