C21H17ClN6O2 — CID 23485264
6-N-(3-chloro-4-methylphenyl)-4-N-(2-methylquinolin-8-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23485264) has the molecular formula C21H17ClN6O2 and a molecular weight of 420.86 g/mol. Its IUPAC name is 6-N-(3-chloro-4-methylphenyl)-4-N-(2-methylquinolin-8-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-chloro-4-methylphenyl)-4-N-(2-methylquinolin-8-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23485264 |
| Molecular Formula | C21H17ClN6O2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 6-N-(3-chloro-4-methylphenyl)-4-N-(2-methylquinolin-8-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc2cccc(Nc3ncnc(Nc4ccc(C)c(Cl)c4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C21H17ClN6O2/c1-12-6-9-15(10-16(12)22)26-20-19(28(29)30)21(24-11-23-20)27-17-5-3-4-14-8-7-13(2)25-18(14)17/h3-11H,1-2H3,(H2,23,24,26,27) |
| InChIKey | QVNWZSNIDGIYJQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|