C16H19N7O3 — CID 23492154
N'-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 23492154) has the molecular formula C16H19N7O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is N'-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 23492154 |
| Molecular Formula | C16H19N7O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N'-[6-(2-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | CC1CCCCN1c1ncnc(NNC(=O)c2cccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N7O3/c1-11-5-2-3-8-22(11)15-13(23(25)26)14(18-10-19-15)20-21-16(24)12-6-4-7-17-9-12/h4,6-7,9-11H,2-3,5,8H2,1H3,(H,21,24)(H,18,19,20) |
| InChIKey | RDIINLKTZLQISQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|