C11H17N5O3 — CID 112726566
6-(4-methoxypiperidin-1-yl)-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 112726566) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-(4-methoxypiperidin-1-yl)-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-methoxypiperidin-1-yl)-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 112726566 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 6-(4-methoxypiperidin-1-yl)-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(N2CCC(OC)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N5O3/c1-12-10-9(16(17)18)11(14-7-13-10)15-5-3-8(19-2)4-6-15/h7-8H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | ZVWAQJFCPCBVBC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|