C13H21N5O2 — CID 23487487
6-(4-methylpiperidin-1-yl)-5-nitro-N-propan-2-ylpyrimidin-4-amine (PubChem CID 23487487) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6-(4-methylpiperidin-1-yl)-5-nitro-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-(4-methylpiperidin-1-yl)-5-nitro-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23487487 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 6-(4-methylpiperidin-1-yl)-5-nitro-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CC1CCN(c2ncnc(NC(C)C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H21N5O2/c1-9(2)16-12-11(18(19)20)13(15-8-14-12)17-6-4-10(3)5-7-17/h8-10H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | WTUUDDNKYKRLKD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|