C14H21N5O4 — CID 23487634
methyl 1-[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23487634) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 1-[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23487634 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | methyl 1-[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(NC(C)C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H21N5O4/c1-9(2)17-12-11(19(21)22)13(16-8-15-12)18-6-4-10(5-7-18)14(20)23-3/h8-10H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | TZGMZCZXDTVZSI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|