C17H26N6O5 — CID 23492722
methyl 1-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23492722) has the molecular formula C17H26N6O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is methyl 1-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23492722 |
| Molecular Formula | C17H26N6O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl 1-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(N3CCN(CCO)CC3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26N6O5/c1-28-17(25)13-2-4-21(5-3-13)15-14(23(26)27)16(19-12-18-15)22-8-6-20(7-9-22)10-11-24/h12-13,24H,2-11H2,1H3 |
| InChIKey | DGUQAMBQEAWARK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|