C16H20N8O5 — CID 23492602
2-[4-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 23492602) has the molecular formula C16H20N8O5 and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-[4-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 23492602 |
| Molecular Formula | C16H20N8O5 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-[4-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(NNc2ncnc(N3CCN(CCO)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H20N8O5/c25-10-9-21-5-7-22(8-6-21)16-14(24(28)29)15(17-11-18-16)20-19-12-1-3-13(4-2-12)23(26)27/h1-4,11,19,25H,5-10H2,(H,17,18,20) |
| InChIKey | RSYYKXJXMBMVKS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 162.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|