C17H23N7O5S — CID 23492683
N'-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 23492683) has the molecular formula C17H23N7O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N'-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 23492683 |
| Molecular Formula | C17H23N7O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N'-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(N3CCN(CCO)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H23N7O5S/c1-13-2-4-14(5-3-13)30(28,29)21-20-16-15(24(26)27)17(19-12-18-16)23-8-6-22(7-9-23)10-11-25/h2-5,12,21,25H,6-11H2,1H3,(H,18,19,20) |
| InChIKey | VXZOLTXUGULUJP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|