C18H18F3N5O5 — CID 22538532
methyl 1-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 22538532) has the molecular formula C18H18F3N5O5 and a molecular weight of 441.37 g/mol. Its IUPAC name is methyl 1-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22538532 |
| Molecular Formula | C18H18F3N5O5 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | methyl 1-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(Nc3ccc(OC(F)(F)F)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H18F3N5O5/c1-30-17(27)11-6-8-25(9-7-11)16-14(26(28)29)15(22-10-23-16)24-12-2-4-13(5-3-12)31-18(19,20)21/h2-5,10-11H,6-9H2,1H3,(H,22,23,24) |
| InChIKey | VQZXYISLPQSDRN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|