C18H18N6O4S — CID 3296139
2,6-dimethyl-4-[5-nitro-6-[4-(thiadiazol-4-yl)phenoxy]pyrimidin-4-yl]morpholine (PubChem CID 3296139) has the molecular formula C18H18N6O4S and a molecular weight of 414.45 g/mol. Its IUPAC name is 2,6-dimethyl-4-[5-nitro-6-[4-(thiadiazol-4-yl)phenoxy]pyrimidin-4-yl]morpholine.
| Compound Name | 2,6-dimethyl-4-[5-nitro-6-[4-(thiadiazol-4-yl)phenoxy]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 3296139 |
| Molecular Formula | C18H18N6O4S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2,6-dimethyl-4-[5-nitro-6-[4-(thiadiazol-4-yl)phenoxy]pyrimidin-4-yl]morpholine |
| SMILES | CC1CN(c2ncnc(Oc3ccc(-c4csnn4)cc3)c2[N+](=O)[O-])CC(C)O1 |
| InChI | InChI=1S/C18H18N6O4S/c1-11-7-23(8-12(2)27-11)17-16(24(25)26)18(20-10-19-17)28-14-5-3-13(4-6-14)15-9-29-22-21-15/h3-6,9-12H,7-8H2,1-2H3 |
| InChIKey | OMSBUKXUJQBERB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 116.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|