C15H18N4O2S — CID 60577463
2,6-dimethyl-N-[4-(thiadiazol-4-yl)phenyl]morpholine-4-carboxamide (PubChem CID 60577463) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2,6-dimethyl-N-[4-(thiadiazol-4-yl)phenyl]morpholine-4-carboxamide.
| Compound Name | 2,6-dimethyl-N-[4-(thiadiazol-4-yl)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 60577463 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2,6-dimethyl-N-[4-(thiadiazol-4-yl)phenyl]morpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(-c3csnn3)cc2)CC(C)O1 |
| InChI | InChI=1S/C15H18N4O2S/c1-10-7-19(8-11(2)21-10)15(20)16-13-5-3-12(4-6-13)14-9-22-18-17-14/h3-6,9-11H,7-8H2,1-2H3,(H,16,20) |
| InChIKey | GDMGWRHWHSAJCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |