C13H18N2O2 — CID 42545481
(2S,6R)-2,6-dimethyl-N-phenylmorpholine-4-carboxamide (PubChem CID 42545481) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-N-phenylmorpholine-4-carboxamide.
| Compound Name | (2S,6R)-2,6-dimethyl-N-phenylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 42545481 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-N-phenylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H18N2O2/c1-10-8-15(9-11(2)17-10)13(16)14-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3,(H,14,16)/t10-,11+ |
| InChIKey | MGCIRSKGOOGNNJ-PHIMTYICSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |