C20H23N3O3 — CID 108504006
N-(4-anilinophenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide (PubChem CID 108504006) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide.
| Compound Name | N-(4-anilinophenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108504006 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-(4-anilinophenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
| SMILES | CC1CN(C(=O)C(=O)Nc2ccc(Nc3ccccc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-12-23(13-15(2)26-14)20(25)19(24)22-18-10-8-17(9-11-18)21-16-6-4-3-5-7-16/h3-11,14-15,21H,12-13H2,1-2H3,(H,22,24) |
| InChIKey | XXRGHCCEHMGNLI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|