C26H27N3O2 — CID 108507023
N-(4-anilinophenyl)-2-(4-benzylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108507023) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(4-benzylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(4-anilinophenyl)-2-(4-benzylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108507023 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-(4-anilinophenyl)-2-(4-benzylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H27N3O2/c30-25(28-24-13-11-23(12-14-24)27-22-9-5-2-6-10-22)26(31)29-17-15-21(16-18-29)19-20-7-3-1-4-8-20/h1-14,21,27H,15-19H2,(H,28,30) |
| InChIKey | WGXVONIAKYLAIP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|