C27H34N4O5 — CID 69099965
tert-butyl N-[2-[3-[[2-(4-benzylpiperidin-1-yl)-2-oxoacetyl]amino]anilino]-2-oxoethyl]carbamate (PubChem CID 69099965) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[2-(4-benzylpiperidin-1-yl)-2-oxoacetyl]amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[2-(4-benzylpiperidin-1-yl)-2-oxoacetyl]amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 69099965 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | tert-butyl N-[2-[3-[[2-(4-benzylpiperidin-1-yl)-2-oxoacetyl]amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1cccc(NC(=O)C(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H34N4O5/c1-27(2,3)36-26(35)28-18-23(32)29-21-10-7-11-22(17-21)30-24(33)25(34)31-14-12-20(13-15-31)16-19-8-5-4-6-9-19/h4-11,17,20H,12-16,18H2,1-3H3,(H,28,35)(H,29,32)(H,30,33) |
| InChIKey | COFUKAOEODVLHG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|