C21H31N3O4 — CID 108917245
tert-butyl N-[2-[3-[(2-cyclohexylacetyl)amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108917245) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(2-cyclohexylacetyl)amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(2-cyclohexylacetyl)amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917245 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[2-[3-[(2-cyclohexylacetyl)amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1cccc(NC(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C21H31N3O4/c1-21(2,3)28-20(27)22-14-19(26)24-17-11-7-10-16(13-17)23-18(25)12-15-8-5-4-6-9-15/h7,10-11,13,15H,4-6,8-9,12,14H2,1-3H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | WTWFNGVLBMQQJG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |