About N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide
N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide (PubChem CID 108503965) has the molecular formula C18H26N2O5
and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide.
Molecular Properties
| Compound Name | N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
| PubChem CID | 108503965 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)N2CC(C)OC(C)C2)cc1OCC |
| InChI | InChI=1S/C18H26N2O5/c1-5-23-15-8-7-14(9-16(15)24-6-2)19-17(21)18(22)20-10-12(3)25-13(4)11-20/h7-9,12-13H,5-6,10-11H2,1-4H3,(H,19,21) |
| InChIKey | AYMRPQJLQIVIPU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide?
The IUPAC name of N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide (CID 108503965) is N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide.
What is the SMILES notation for N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide?
The canonical SMILES for N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide is CCOc1ccc(NC(=O)C(=O)N2CC(C)OC(C)C2)cc1OCC.
What is the InChIKey of N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide?
The InChIKey is AYMRPQJLQIVIPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O5/c1-5-23-15-8-7-14(9-16(15)24-6-2)19-17(21)18(22)20-10-12(3)25-13(4)11-20/h7-9,12-13H,5-6,10-11H2,1-4H3,(H,19,21).
What are the key properties of N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide?
N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide has a molecular weight of 350.42 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide is sourced from PubChem (CID 108503965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).