C18H26N2O5 — CID 108503965
N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide (PubChem CID 108503965) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108503965 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)N2CC(C)OC(C)C2)cc1OCC |
| InChI | InChI=1S/C18H26N2O5/c1-5-23-15-8-7-14(9-16(15)24-6-2)19-17(21)18(22)20-10-12(3)25-13(4)11-20/h7-9,12-13H,5-6,10-11H2,1-4H3,(H,19,21) |
| InChIKey | AYMRPQJLQIVIPU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|