C19H28N4O3 — CID 108504026
2-(2,6-dimethylmorpholin-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxoacetamide (PubChem CID 108504026) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxoacetamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108504026 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxoacetamide |
| SMILES | CC1CN(C(=O)C(=O)Nc2ccc(N3CCN(C)CC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C19H28N4O3/c1-14-12-23(13-15(2)26-14)19(25)18(24)20-16-4-6-17(7-5-16)22-10-8-21(3)9-11-22/h4-7,14-15H,8-13H2,1-3H3,(H,20,24) |
| InChIKey | FQZGQLNWHFJKBH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|