C17H23N3O3 — CID 39201040
(Z)-2,3-dimethyl-4-[4-(4-methylpiperazin-1-yl)anilino]-4-oxobut-2-enoic acid (PubChem CID 39201040) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (Z)-2,3-dimethyl-4-[4-(4-methylpiperazin-1-yl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2,3-dimethyl-4-[4-(4-methylpiperazin-1-yl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 39201040 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (Z)-2,3-dimethyl-4-[4-(4-methylpiperazin-1-yl)anilino]-4-oxobut-2-enoic acid |
| SMILES | C/C(C(=O)O)=C(\C)C(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-12(13(2)17(22)23)16(21)18-14-4-6-15(7-5-14)20-10-8-19(3)9-11-20/h4-7H,8-11H2,1-3H3,(H,18,21)(H,22,23)/b13-12- |
| InChIKey | JLSHEUXMHWXUEZ-SEYXRHQNSA-N |
| XLogP | 1.80 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|