C21H25N5O3 — CID 108526491
N'-(3-acetamidophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]oxamide (PubChem CID 108526491) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N'-(3-acetamidophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]oxamide.
| Compound Name | N'-(3-acetamidophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 108526491 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N'-(3-acetamidophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)Nc2ccc(N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C21H25N5O3/c1-15(27)22-17-4-3-5-18(14-17)24-21(29)20(28)23-16-6-8-19(9-7-16)26-12-10-25(2)11-13-26/h3-9,14H,10-13H2,1-2H3,(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | WQGZWJISYBTHFX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|