C21H24N4O4 — CID 44902805
N-(3-acetamidophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 44902805) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 44902805 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | COc1ccc(N2CCN(C(=O)C(=O)Nc3cccc(NC(C)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O4/c1-15(26)22-16-4-3-5-17(14-16)23-20(27)21(28)25-12-10-24(11-13-25)18-6-8-19(29-2)9-7-18/h3-9,14H,10-13H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | GHSORZXILOAWOQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|