C20H25N3O2S — CID 60611860
N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 60611860) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 60611860 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(N3CCc4sccc4C3)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H25N3O2S/c1-14-11-23(12-15(2)25-14)20(24)21-17-3-5-18(6-4-17)22-9-7-19-16(13-22)8-10-26-19/h3-6,8,10,14-15H,7,9,11-13H2,1-2H3,(H,21,24) |
| InChIKey | OTIDFUPGTPWNFD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|