C17H25N3O2S — CID 95302613
N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]thiomorpholine-4-carboxamide (PubChem CID 95302613) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]thiomorpholine-4-carboxamide.
| Compound Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 95302613 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]thiomorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)N3CCSCC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H25N3O2S/c1-13-11-20(12-14(2)22-13)16-5-3-15(4-6-16)18-17(21)19-7-9-23-10-8-19/h3-6,13-14H,7-12H2,1-2H3,(H,18,21)/t13-,14+ |
| InChIKey | MYVCVBCNJUUXQO-OKILXGFUSA-N |
| XLogP | 2.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|