C17H25N3O2 — CID 94336075
1-(cyclopropylmethyl)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]urea (PubChem CID 94336075) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]urea.
| Compound Name | 1-(cyclopropylmethyl)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 94336075 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]urea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)NCC3CC3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H25N3O2/c1-12-10-20(11-13(2)22-12)16-7-5-15(6-8-16)19-17(21)18-9-14-3-4-14/h5-8,12-14H,3-4,9-11H2,1-2H3,(H2,18,19,21)/t12-,13-/m1/s1 |
| InChIKey | ZENVEDCQTPJQEB-CHWSQXEVSA-N |
| XLogP | 2.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|