C14H20N2O2S — CID 6934493
O-methyl N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]carbamothioate (PubChem CID 6934493) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is O-methyl N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]carbamothioate.
| Compound Name | O-methyl N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 6934493 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | O-methyl N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]carbamothioate |
| SMILES | COC(=S)Nc1ccc(N2C[C@@H](C)O[C@H](C)C2)cc1 |
| InChI | InChI=1S/C14H20N2O2S/c1-10-8-16(9-11(2)18-10)13-6-4-12(5-7-13)15-14(19)17-3/h4-7,10-11H,8-9H2,1-3H3,(H,15,19)/t10-,11-/m1/s1 |
| InChIKey | ULYNWOLMGAATCZ-GHMZBOCLSA-N |
| XLogP | 2.64 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|