C18H23N3O2S — CID 6924142
1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 6924142) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 6924142 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=S)NCc3ccco3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H23N3O2S/c1-13-11-21(12-14(2)23-13)16-7-5-15(6-8-16)20-18(24)19-10-17-4-3-9-22-17/h3-9,13-14H,10-12H2,1-2H3,(H2,19,20,24)/t13-,14-/m1/s1 |
| InChIKey | IIDONZOYLIWLMU-ZIAGYGMSSA-N |
| XLogP | 3.38 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|