C12H18N2O3 — CID 47125598
N-(furan-2-ylmethyl)-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 47125598) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 47125598 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)NCc2ccco2)CC(C)O1 |
| InChI | InChI=1S/C12H18N2O3/c1-9-7-14(8-10(2)17-9)12(15)13-6-11-4-3-5-16-11/h3-5,9-10H,6-8H2,1-2H3,(H,13,15) |
| InChIKey | CQYSLVRFVBTDLE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |