C15H16N2O2 — CID 16645751
N-(furan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 16645751) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 16645751 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(NCc1ccco1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H16N2O2/c18-15(16-10-14-6-3-9-19-14)17-8-7-12-4-1-2-5-13(12)11-17/h1-6,9H,7-8,10-11H2,(H,16,18) |
| InChIKey | XGQRUVWSGLKDDJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |