C22H30N4O4 — CID 154908208
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide;formic acid (PubChem CID 154908208) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide;formic acid.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154908208 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide;formic acid |
| SMILES | O=C(NCCN1CCc2ccccc2C1)N1CCN(Cc2ccco2)CC1.O=CO |
| InChI | InChI=1S/C21H28N4O2.CH2O2/c26-21(25-13-11-24(12-14-25)17-20-6-3-15-27-20)22-8-10-23-9-7-18-4-1-2-5-19(18)16-23;2-1-3/h1-6,15H,7-14,16-17H2,(H,22,26);1H,(H,2,3) |
| InChIKey | GHZXIVQUQLGSTD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|