C22H35N3O4 — CID 97225791
tert-butyl (2S)-2-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]carbamoylamino]-3-methylbutanoate (PubChem CID 97225791) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]carbamoylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 97225791 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | tert-butyl (2S)-2-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]carbamoylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccc(N2C[C@H](C)O[C@@H](C)C2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O4/c1-14(2)19(20(26)29-22(5,6)7)24-21(27)23-17-8-10-18(11-9-17)25-12-15(3)28-16(4)13-25/h8-11,14-16,19H,12-13H2,1-7H3,(H2,23,24,27)/t15-,16-,19-/m0/s1 |
| InChIKey | XCWDLWAGINOBRY-BXWFABGCSA-N |
| XLogP | 3.79 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|