C24H38N4O4 — CID 86812976
tert-butyl N-[1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoyl]piperidin-3-yl]-N-methylcarbamate (PubChem CID 86812976) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoyl]piperidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoyl]piperidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86812976 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | tert-butyl N-[1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoyl]piperidin-3-yl]-N-methylcarbamate |
| SMILES | CC1CN(c2ccc(NC(=O)N3CCCC(N(C)C(=O)OC(C)(C)C)C3)cc2)CC(C)O1 |
| InChI | InChI=1S/C24H38N4O4/c1-17-14-28(15-18(2)31-17)20-11-9-19(10-12-20)25-22(29)27-13-7-8-21(16-27)26(6)23(30)32-24(3,4)5/h9-12,17-18,21H,7-8,13-16H2,1-6H3,(H,25,29) |
| InChIKey | WXHTZBXZAHLIRN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|