C19H29N3O3 — CID 95057139
N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2,2-dimethylmorpholine-4-carboxamide (PubChem CID 95057139) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2,2-dimethylmorpholine-4-carboxamide.
| Compound Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2,2-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 95057139 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2,2-dimethylmorpholine-4-carboxamide |
| SMILES | C[C@H]1CN(c2ccc(NC(=O)N3CCOC(C)(C)C3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H29N3O3/c1-14-11-22(12-15(2)25-14)17-7-5-16(6-8-17)20-18(23)21-9-10-24-19(3,4)13-21/h5-8,14-15H,9-13H2,1-4H3,(H,20,23)/t14-,15-/m0/s1 |
| InChIKey | GIZCBEGUFSCSKX-GJZGRUSLSA-N |
| XLogP | 2.94 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|