2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid

C14H18N2O4 — CID 61202030

IUPAC2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid
SMILESCC1(C)CN(C(=O)Nc2ccccc2C(=O)O)CCO1
InChIInChI=1S/C14H18N2O4/c1-14(2)9-16(7-8-20-14)13(19)15-11-6-4-3-5-10(11)12(17)18/h3-6H,7-9H2,1-2H3,(H,15,19)(H,17,18)
InChIKeyVDHDTNWUMYOGHW-UHFFFAOYSA-N
MW278.31 g/mol
LogP2.03
Rot. Bonds2

About 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid

2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid (PubChem CID 61202030) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid.

Molecular Properties

Compound Name2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid
PubChem CID61202030
Molecular FormulaC14H18N2O4
Molecular Weight278.31 g/mol
Exact Mass278.13
IUPAC Name2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid
SMILESCC1(C)CN(C(=O)Nc2ccccc2C(=O)O)CCO1
InChIInChI=1S/C14H18N2O4/c1-14(2)9-16(7-8-20-14)13(19)15-11-6-4-3-5-10(11)12(17)18/h3-6H,7-9H2,1-2H3,(H,15,19)(H,17,18)
InChIKeyVDHDTNWUMYOGHW-UHFFFAOYSA-N
XLogP2.03
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.31
LogP ≤ 52.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid?
The IUPAC name of 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid (CID 61202030) is 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid.
What is the SMILES notation for 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid?
The canonical SMILES for 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid is CC1(C)CN(C(=O)Nc2ccccc2C(=O)O)CCO1.
What is the InChIKey of 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid?
The InChIKey is VDHDTNWUMYOGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4/c1-14(2)9-16(7-8-20-14)13(19)15-11-6-4-3-5-10(11)12(17)18/h3-6H,7-9H2,1-2H3,(H,15,19)(H,17,18).
What are the key properties of 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid?
2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid has a molecular weight of 278.31 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid is sourced from PubChem (CID 61202030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).