C14H18N2O4 — CID 61202030
2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid (PubChem CID 61202030) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61202030 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[(2,2-dimethylmorpholine-4-carbonyl)amino]benzoic acid |
| SMILES | CC1(C)CN(C(=O)Nc2ccccc2C(=O)O)CCO1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2)9-16(7-8-20-14)13(19)15-11-6-4-3-5-10(11)12(17)18/h3-6H,7-9H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | VDHDTNWUMYOGHW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |