C15H20N2O4 — CID 61202574
(2R)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]-2-phenylacetic acid (PubChem CID 61202574) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2R)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 61202574 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2R)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]-2-phenylacetic acid |
| SMILES | CC1(C)CN(C(=O)N[C@@H](C(=O)O)c2ccccc2)CCO1 |
| InChI | InChI=1S/C15H20N2O4/c1-15(2)10-17(8-9-21-15)14(20)16-12(13(18)19)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,16,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | WBIMWTHAZRZZPL-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |