(2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid

C10H18N2O4 — CID 61202221

IUPAC(2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid
SMILESC[C@H](NC(=O)N1CCOC(C)(C)C1)C(=O)O
InChIInChI=1S/C10H18N2O4/c1-7(8(13)14)11-9(15)12-4-5-16-10(2,3)6-12/h7H,4-6H2,1-3H3,(H,11,15)(H,13,14)/t7-/m0/s1
InChIKeyOAKAKDRNCVNFFI-ZETCQYMHSA-N
MW230.26 g/mol
LogP0.28
Rot. Bonds2

About (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid

(2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid (PubChem CID 61202221) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid.

Molecular Properties

Compound Name(2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid
PubChem CID61202221
Molecular FormulaC10H18N2O4
Molecular Weight230.26 g/mol
Exact Mass230.13
IUPAC Name(2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid
SMILESC[C@H](NC(=O)N1CCOC(C)(C)C1)C(=O)O
InChIInChI=1S/C10H18N2O4/c1-7(8(13)14)11-9(15)12-4-5-16-10(2,3)6-12/h7H,4-6H2,1-3H3,(H,11,15)(H,13,14)/t7-/m0/s1
InChIKeyOAKAKDRNCVNFFI-ZETCQYMHSA-N
XLogP0.28
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 50.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid?
The IUPAC name of (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid (CID 61202221) is (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid?
The canonical SMILES for (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid is C[C@H](NC(=O)N1CCOC(C)(C)C1)C(=O)O.
What is the InChIKey of (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid?
The InChIKey is OAKAKDRNCVNFFI-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H18N2O4/c1-7(8(13)14)11-9(15)12-4-5-16-10(2,3)6-12/h7H,4-6H2,1-3H3,(H,11,15)(H,13,14)/t7-/m0/s1.
What are the key properties of (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid?
(2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid has a molecular weight of 230.26 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,2-dimethylmorpholine-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 61202221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).